Difference between revisions of "FRUCTOSE-6P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite m7G5-pppRm-mRNAs == * common-name: ** a 5'-(n7-methyl 5'-triphosphoguanosine)-(2'-o-methyl-purine-ribonucleotide)-[mrna] == Reaction(s) k...") |
(Created page with "Category:metabolite == Metabolite ASN == * common-name: ** l-asparagine * molecular-weight: ** 132.119 * inchi-key: ** dcxyfedjocdnaf-reohclbhsa-n * smiles: ** c(cc(c(=o)[...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ASN == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-asparagine |
| + | * molecular-weight: | ||
| + | ** 132.119 | ||
| + | * inchi-key: | ||
| + | ** dcxyfedjocdnaf-reohclbhsa-n | ||
| + | * smiles: | ||
| + | ** c(cc(c(=o)[o-])[n+])(n)=o | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[ASPARAGHYD-RXN]] | ||
| + | * [[ASPARAGINE--TRNA-LIGASE-RXN]] | ||
| + | * [[biomass_rxn]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ASNSYNA-RXN]] |
| + | * [[ASNSYNB-RXN]] | ||
| + | * [[RXN-12460]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-asparagine}} |
| + | {{#set: molecular-weight=132.119}} | ||
| + | {{#set: inchi-key=inchikey=dcxyfedjocdnaf-reohclbhsa-n}} | ||
Revision as of 19:03, 17 March 2021
Contents
Metabolite ASN
- common-name:
- l-asparagine
- molecular-weight:
- 132.119
- inchi-key:
- dcxyfedjocdnaf-reohclbhsa-n
- smiles:
- c(cc(c(=o)[o-])[n+])(n)=o
