Difference between revisions of "COUMARATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE == * common-name: ** (5z,8z,11z,14z,17z)-icosapentaenoate * molecular-weight: ** 301.448 * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite COUMARATE == * common-name: ** 4-coumarate * molecular-weight: ** 163.152 * inchi-key: ** ngswkaqjjwesns-zzxkwvifsa-m * smiles: ** c(=o)(...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE ==
+
== Metabolite COUMARATE ==
 
* common-name:
 
* common-name:
** (5z,8z,11z,14z,17z)-icosapentaenoate
+
** 4-coumarate
 
* molecular-weight:
 
* molecular-weight:
** 301.448
+
** 163.152
 
* inchi-key:
 
* inchi-key:
** jazbehyotptenj-jlnkqsitsa-m
+
** ngswkaqjjwesns-zzxkwvifsa-m
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccc=ccc=ccccc(=o)[o-]
+
** c(=o)([o-])c=cc1(=cc=c(o)c=c1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12978]]
+
* [[4-COUMARATE--COA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13431]]
 
* [[RXN-16139]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(5z,8z,11z,14z,17z)-icosapentaenoate}}
+
{{#set: common-name=4-coumarate}}
{{#set: molecular-weight=301.448}}
+
{{#set: molecular-weight=163.152}}
{{#set: inchi-key=inchikey=jazbehyotptenj-jlnkqsitsa-m}}
+
{{#set: inchi-key=inchikey=ngswkaqjjwesns-zzxkwvifsa-m}}

Latest revision as of 19:32, 17 March 2021

Metabolite COUMARATE

  • common-name:
    • 4-coumarate
  • molecular-weight:
    • 163.152
  • inchi-key:
    • ngswkaqjjwesns-zzxkwvifsa-m
  • smiles:
    • c(=o)([o-])c=cc1(=cc=c(o)c=c1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality