Difference between revisions of "COUMARATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE == * common-name: ** (5z,8z,11z,14z,17z)-icosapentaenoate * molecular-weight: ** 301.448 * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite COUMARATE == * common-name: ** 4-coumarate * molecular-weight: ** 163.152 * inchi-key: ** ngswkaqjjwesns-zzxkwvifsa-m * smiles: ** c(=o)(...") |
||
(2 intermediate revisions by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite COUMARATE == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-coumarate |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 163.152 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ngswkaqjjwesns-zzxkwvifsa-m |
* smiles: | * smiles: | ||
− | ** | + | ** c(=o)([o-])c=cc1(=cc=c(o)c=c1) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[4-COUMARATE--COA-LIGASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-coumarate}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=163.152}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ngswkaqjjwesns-zzxkwvifsa-m}} |
Latest revision as of 19:32, 17 March 2021
Contents
Metabolite COUMARATE
- common-name:
- 4-coumarate
- molecular-weight:
- 163.152
- inchi-key:
- ngswkaqjjwesns-zzxkwvifsa-m
- smiles:
- c(=o)([o-])c=cc1(=cc=c(o)c=c1)