Difference between revisions of "5Z8Z11Z14Z17Z-EICOSAPENTAENOATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Myelin-L-arginines == * common_name: ** [myelin basic protein]-l-arginine == Reaction(s) known to consume the compound == * 2.1.1.126-R...") |
(Created page with "Category:metabolite == Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE == * common-name: ** (5z,8z,11z,14z,17z)-icosapentaenoate * molecular-weight: ** 301.448 * inchi-key: **...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE == |
− | * | + | * common-name: |
− | ** [ | + | ** (5z,8z,11z,14z,17z)-icosapentaenoate |
+ | * molecular-weight: | ||
+ | ** 301.448 | ||
+ | * inchi-key: | ||
+ | ** jazbehyotptenj-jlnkqsitsa-m | ||
+ | * smiles: | ||
+ | ** ccc=ccc=ccc=ccc=ccc=ccccc(=o)[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-12978]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-13431]] | ||
+ | * [[RXN-16139]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: | + | {{#set: common-name=(5z,8z,11z,14z,17z)-icosapentaenoate}} |
+ | {{#set: molecular-weight=301.448}} | ||
+ | {{#set: inchi-key=inchikey=jazbehyotptenj-jlnkqsitsa-m}} |
Latest revision as of 19:32, 17 March 2021
Contents
Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE
- common-name:
- (5z,8z,11z,14z,17z)-icosapentaenoate
- molecular-weight:
- 301.448
- inchi-key:
- jazbehyotptenj-jlnkqsitsa-m
- smiles:
- ccc=ccc=ccc=ccc=ccc=ccccc(=o)[o-]