Difference between revisions of "3-METHYLSULFINYLPROPYL-GLUCOSINOLATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Secondary-Alcohols == * common-name: ** a secondary alcohol == Reaction(s) known to consume the compound == * CARBONYL-REDUCTASE-NADPH-...") |
(Created page with "Category:metabolite == Metabolite 3-METHYLSULFINYLPROPYL-GLUCOSINOLATE == * common-name: ** glucoiberin * molecular-weight: ** 422.46 * inchi-key: ** phyyadmvyqursx-wwfizp...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 3-METHYLSULFINYLPROPYL-GLUCOSINOLATE == |
* common-name: | * common-name: | ||
− | ** | + | ** glucoiberin |
+ | * molecular-weight: | ||
+ | ** 422.46 | ||
+ | * inchi-key: | ||
+ | ** phyyadmvyqursx-wwfizpdbsa-m | ||
+ | * smiles: | ||
+ | ** cs(=o)cccc(=nos(=o)(=o)[o-])sc1(oc(co)c(o)c(o)c(o)1) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-2221]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=glucoiberin}} |
+ | {{#set: molecular-weight=422.46}} | ||
+ | {{#set: inchi-key=inchikey=phyyadmvyqursx-wwfizpdbsa-m}} |
Latest revision as of 19:32, 17 March 2021
Contents
Metabolite 3-METHYLSULFINYLPROPYL-GLUCOSINOLATE
- common-name:
- glucoiberin
- molecular-weight:
- 422.46
- inchi-key:
- phyyadmvyqursx-wwfizpdbsa-m
- smiles:
- cs(=o)cccc(=nos(=o)(=o)[o-])sc1(oc(co)c(o)c(o)c(o)1)