Difference between revisions of "ADENYLOSUCC"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite METOH == * common-name: ** methanol * molecular-weight: ** 32.042 * inchi-key: ** okkjlvbelutlkv-uhfffaoysa-n * smiles: ** co == Reaction...")
(Created page with "Category:metabolite == Metabolite ADENYLOSUCC == * common-name: ** adenylo-succinate * molecular-weight: ** 459.265 * inchi-key: ** ofbhppmpbojxrt-dpxqiynjsa-j * smiles: *...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite METOH ==
+
== Metabolite ADENYLOSUCC ==
 
* common-name:
 
* common-name:
** methanol
+
** adenylo-succinate
 
* molecular-weight:
 
* molecular-weight:
** 32.042
+
** 459.265
 
* inchi-key:
 
* inchi-key:
** okkjlvbelutlkv-uhfffaoysa-n
+
** ofbhppmpbojxrt-dpxqiynjsa-j
 
* smiles:
 
* smiles:
** co
+
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=nc=nc=23)nc(cc(=o)[o-])c(=o)[o-])))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14189]]
+
* [[AMPSYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10711]]
+
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
* [[RXN-10767]]
+
* [[AMPSYN-RXN]]
* [[RXNQT-4366]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=methanol}}
+
{{#set: common-name=adenylo-succinate}}
{{#set: molecular-weight=32.042}}
+
{{#set: molecular-weight=459.265}}
{{#set: inchi-key=inchikey=okkjlvbelutlkv-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=ofbhppmpbojxrt-dpxqiynjsa-j}}

Latest revision as of 19:33, 17 March 2021

Metabolite ADENYLOSUCC

  • common-name:
    • adenylo-succinate
  • molecular-weight:
    • 459.265
  • inchi-key:
    • ofbhppmpbojxrt-dpxqiynjsa-j
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=nc=nc=23)nc(cc(=o)[o-])c(=o)[o-])))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality