Difference between revisions of "2-hydroxyacyl-glutathiones"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite TMP == * common-name: ** dtmp * molecular-weight: ** 320.195 * inchi-key: ** gyozywvxfndglu-xlpzgreqsa-l * smiles: ** cc1(=cn(c(=o)nc(=o)...")
(Created page with "Category:metabolite == Metabolite 2-hydroxyacyl-glutathiones == * common-name: ** s-(2-hydroxyacyl)glutathione == Reaction(s) known to consume the compound == * RXN-7919...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite TMP ==
+
== Metabolite 2-hydroxyacyl-glutathiones ==
 
* common-name:
 
* common-name:
** dtmp
+
** s-(2-hydroxyacyl)glutathione
* molecular-weight:
 
** 320.195
 
* inchi-key:
 
** gyozywvxfndglu-xlpzgreqsa-l
 
* smiles:
 
** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])[o-])o2))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DTMPKI-RXN]]
+
* [[RXN-7919]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-5107]]
 
* [[THYMIDYLATESYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dtmp}}
+
{{#set: common-name=s-(2-hydroxyacyl)glutathione}}
{{#set: molecular-weight=320.195}}
 
{{#set: inchi-key=inchikey=gyozywvxfndglu-xlpzgreqsa-l}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite 2-hydroxyacyl-glutathiones

  • common-name:
    • s-(2-hydroxyacyl)glutathione

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality