Difference between revisions of "3-carboxy-3-dimethylammonio-propyl-L-his"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17815 == * common-name: ** (11z)-3-oxo-hexadecenoyl-coa * molecular-weight: ** 1013.883 * inchi-key: ** lgtvdwicxibioi-ubpkjmqesa-j *...")
(Created page with "Category:metabolite == Metabolite 3-carboxy-3-dimethylammonio-propyl-L-his == * common-name: ** a 2-[(3s)-3-carboxy-3-(dimethylammonio)propyl]-l-histidine-[translation elo...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-17815 ==
+
== Metabolite 3-carboxy-3-dimethylammonio-propyl-L-his ==
 
* common-name:
 
* common-name:
−
** (11z)-3-oxo-hexadecenoyl-coa
+
** a 2-[(3s)-3-carboxy-3-(dimethylammonio)propyl]-l-histidine-[translation elongation factor 2]
−
* molecular-weight:
 
−
** 1013.883
 
−
* inchi-key:
 
−
** lgtvdwicxibioi-ubpkjmqesa-j
 
−
* smiles:
 
−
** ccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-16559]]
+
* [[RXN-11373]]
−
* [[RXN-16561]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-16559]]
+
* [[RXN-11374]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=(11z)-3-oxo-hexadecenoyl-coa}}
+
{{#set: common-name=a 2-[(3s)-3-carboxy-3-(dimethylammonio)propyl]-l-histidine-[translation elongation factor 2]}}
−
{{#set: molecular-weight=1013.883}}
 
−
{{#set: inchi-key=inchikey=lgtvdwicxibioi-ubpkjmqesa-j}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite 3-carboxy-3-dimethylammonio-propyl-L-his

  • common-name:
    • a 2-[(3s)-3-carboxy-3-(dimethylammonio)propyl]-l-histidine-[translation elongation factor 2]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 2-[(3s)-3-carboxy-3-(dimethylammonio)propyl]-l-histidine-[translation elongation factor 2" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=3-carboxy-3-dimethylammonio-propyl-L-his&oldid=48608"