Difference between revisions of "CPD-504"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-DIPHOSPHATE == * common-name: ** all-trans-octaprenyl diphosphate * molecular-weight: ** 719.897 * inchi-key: ** ikkldissulffq...")
(Created page with "Category:metabolite == Metabolite CPD-504 == * common-name: ** a 1-monoglyceride == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compou...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OCTAPRENYL-DIPHOSPHATE ==
+
== Metabolite CPD-504 ==
 
* common-name:
 
* common-name:
** all-trans-octaprenyl diphosphate
+
** a 1-monoglyceride
* molecular-weight:
 
** 719.897
 
* inchi-key:
 
** ikkldissulffqo-djmiluhssa-k
 
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-1603]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=all-trans-octaprenyl diphosphate}}
+
{{#set: common-name=a 1-monoglyceride}}
{{#set: molecular-weight=719.897}}
 
{{#set: inchi-key=inchikey=ikkldissulffqo-djmiluhssa-k}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite CPD-504

  • common-name:
    • a 1-monoglyceride

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality