Difference between revisions of "2Fe-2S-proteins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 7-8-DIHYDROPTEROATE == * common-name: ** 7,8-dihydropteroate * molecular-weight: ** 313.295 * inchi-key: ** wbfyvdchgvnrbh-uhfffaoysa-m *...")
 
(Created page with "Category:metabolite == Metabolite 2Fe-2S-proteins == * common-name: ** an [2fe-2s] cluster protein == Reaction(s) known to consume the compound == == Reaction(s) known to...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 7-8-DIHYDROPTEROATE ==
+
== Metabolite 2Fe-2S-proteins ==
 
* common-name:
 
* common-name:
** 7,8-dihydropteroate
+
** an [2fe-2s] cluster protein
* molecular-weight:
 
** 313.295
 
* inchi-key:
 
** wbfyvdchgvnrbh-uhfffaoysa-m
 
* smiles:
 
** c(nc1(=cc=c(c(=o)[o-])c=c1))c3(cnc2(=c(c(=o)nc(n)=n2)n=3))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIHYDROFOLATESYNTH-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[H2PTEROATESYNTH-RXN]]
+
* [[RXN-14390]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7,8-dihydropteroate}}
+
{{#set: common-name=an [2fe-2s] cluster protein}}
{{#set: molecular-weight=313.295}}
 
{{#set: inchi-key=inchikey=wbfyvdchgvnrbh-uhfffaoysa-m}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite 2Fe-2S-proteins

  • common-name:
    • an [2fe-2s] cluster protein

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an [2fe-2s] cluster protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.