Difference between revisions of "I-antigens"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1162 == * common-name: ** (2e,5z)-tetradecenoyl-coa * molecular-weight: ** 969.83 * inchi-key: ** jvefyxpcqbmmaa-zmlwrgbosa-j * smil...")
 
(Created page with "Category:metabolite == Metabolite I-antigens == * common-name: ** an i antigen == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-1162 ==
+
== Metabolite I-antigens ==
 
* common-name:
 
* common-name:
** (2e,5z)-tetradecenoyl-coa
+
** an i antigen
* molecular-weight:
 
** 969.83
 
* inchi-key:
 
** jvefyxpcqbmmaa-zmlwrgbosa-j
 
* smiles:
 
** ccccccccc=ccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5393]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14576]]
+
* [[RXN-15278]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,5z)-tetradecenoyl-coa}}
+
{{#set: common-name=an i antigen}}
{{#set: molecular-weight=969.83}}
 
{{#set: inchi-key=inchikey=jvefyxpcqbmmaa-zmlwrgbosa-j}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite I-antigens

  • common-name:
    • an i antigen

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality