Difference between revisions of "B-KETOACYL-ACP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11402 == * common-name: ** 3,5,3'-triiodo-l-thyronine acyl β-d-glucuronide * molecular-weight: ** 826.095 * inchi-key: ** lqmbvw...")
(Created page with "Category:metabolite == Metabolite B-KETOACYL-ACP == * common-name: ** a 3-oxoacyl-[acp] == Reaction(s) known to consume the compound == * 3-OXOACYL-ACP-REDUCT-RXN == R...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11402 ==
+
== Metabolite B-KETOACYL-ACP ==
 
* common-name:
 
* common-name:
** 3,5,3'-triiodo-l-thyronine acyl β-d-glucuronide
+
** a 3-oxoacyl-[acp]
* molecular-weight:
 
** 826.095
 
* inchi-key:
 
** lqmbvwcqwfepfk-dkbymcrtsa-m
 
* smiles:
 
** c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n)cc2(=cc(i)=c(c(i)=c2)oc3(=cc(i)=c(o)c=c3)))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3-OXOACYL-ACP-REDUCT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10609]]
+
* [[2.3.1.41-RXN]]
 +
* [[3-OXOACYL-ACP-SYNTH-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,5,3'-triiodo-l-thyronine acyl β-d-glucuronide}}
+
{{#set: common-name=a 3-oxoacyl-[acp]}}
{{#set: molecular-weight=826.095}}
 
{{#set: inchi-key=inchikey=lqmbvwcqwfepfk-dkbymcrtsa-m}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite B-KETOACYL-ACP

  • common-name:
    • a 3-oxoacyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 3-oxoacyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.