Difference between revisions of "3-HEXAPRENYL-4-HYDROXYBENZOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite S-Substituted-L-Cysteines == * common-name: ** an l-cysteine-s-conjugate == Reaction(s) known to consume the compound == == Reaction(s) k...")
(Created page with "Category:metabolite == Metabolite 3-HEXAPRENYL-4-HYDROXYBENZOATE == * common-name: ** 3-hexaprenyl-4-hydroxybenzoate * molecular-weight: ** 545.824 * inchi-key: ** lkmqqqa...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite S-Substituted-L-Cysteines ==
+
== Metabolite 3-HEXAPRENYL-4-HYDROXYBENZOATE ==
 
* common-name:
 
* common-name:
** an l-cysteine-s-conjugate
+
** 3-hexaprenyl-4-hydroxybenzoate
 +
* molecular-weight:
 +
** 545.824
 +
* inchi-key:
 +
** lkmqqqabigihgl-laaqxviisa-m
 +
* smiles:
 +
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13684]]
+
* [[RXN-9003]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an l-cysteine-s-conjugate}}
+
{{#set: common-name=3-hexaprenyl-4-hydroxybenzoate}}
 +
{{#set: molecular-weight=545.824}}
 +
{{#set: inchi-key=inchikey=lkmqqqabigihgl-laaqxviisa-m}}

Latest revision as of 19:34, 17 March 2021

Metabolite 3-HEXAPRENYL-4-HYDROXYBENZOATE

  • common-name:
    • 3-hexaprenyl-4-hydroxybenzoate
  • molecular-weight:
    • 545.824
  • inchi-key:
    • lkmqqqabigihgl-laaqxviisa-m
  • smiles:
    • cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality