Difference between revisions of "3-HEXAPRENYL-4-HYDROXYBENZOATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-110 == * common-name: ** salicylate * molecular-weight: ** 137.115 * inchi-key: ** ygsdefsmjlzeoe-uhfffaoysa-m * smiles: ** c(c1(=cc=...") |
(Created page with "Category:metabolite == Metabolite 3-HEXAPRENYL-4-HYDROXYBENZOATE == * common-name: ** 3-hexaprenyl-4-hydroxybenzoate * molecular-weight: ** 545.824 * inchi-key: ** lkmqqqa...") |
||
| (3 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-HEXAPRENYL-4-HYDROXYBENZOATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-hexaprenyl-4-hydroxybenzoate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 545.824 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** lkmqqqabigihgl-laaqxviisa-m |
* smiles: | * smiles: | ||
| − | ** c( | + | ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-9003]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-hexaprenyl-4-hydroxybenzoate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=545.824}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lkmqqqabigihgl-laaqxviisa-m}} |
Latest revision as of 19:34, 17 March 2021
Contents
Metabolite 3-HEXAPRENYL-4-HYDROXYBENZOATE
- common-name:
- 3-hexaprenyl-4-hydroxybenzoate
- molecular-weight:
- 545.824
- inchi-key:
- lkmqqqabigihgl-laaqxviisa-m
- smiles:
- cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c
