Difference between revisions of "3-METHYLTHIOPROPYL-GLUCOSINOLATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite S-2-Hydroxyacids1 == * common-name: ** an (s)-2-hydroxyarboxylate == Reaction(s) known to consume the compound == * S-2-HYDROXY-ACID-OX...") |
(Created page with "Category:metabolite == Metabolite 3-METHYLTHIOPROPYL-GLUCOSINOLATE == * common-name: ** glucoiberverin * molecular-weight: ** 406.46 * inchi-key: ** zczcvjvujgulmo-bzvdqrp...") |
||
(3 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 3-METHYLTHIOPROPYL-GLUCOSINOLATE == |
* common-name: | * common-name: | ||
− | ** | + | ** glucoiberverin |
+ | * molecular-weight: | ||
+ | ** 406.46 | ||
+ | * inchi-key: | ||
+ | ** zczcvjvujgulmo-bzvdqrpcsa-m | ||
+ | * smiles: | ||
+ | ** cscccc(=nos(=o)(=o)[o-])sc1(oc(co)c(o)c(o)c(o)1) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-2221]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=glucoiberverin}} |
+ | {{#set: molecular-weight=406.46}} | ||
+ | {{#set: inchi-key=inchikey=zczcvjvujgulmo-bzvdqrpcsa-m}} |
Latest revision as of 19:34, 17 March 2021
Contents
Metabolite 3-METHYLTHIOPROPYL-GLUCOSINOLATE
- common-name:
- glucoiberverin
- molecular-weight:
- 406.46
- inchi-key:
- zczcvjvujgulmo-bzvdqrpcsa-m
- smiles:
- cscccc(=nos(=o)(=o)[o-])sc1(oc(co)c(o)c(o)c(o)1)