Difference between revisions of "5-HYDROXYINDOLE ACETATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite cis-5-enoyl-CoA == * common-name: ** a (5z)-alkan-5-enoyl-coa == Reaction(s) known to consume the compound == * RXN-12518 == Reaction...") |
(Created page with "Category:metabolite == Metabolite 5-HYDROXYINDOLE_ACETATE == * common-name: ** 5-hydroxyindole acetate * molecular-weight: ** 190.178 * inchi-key: ** duugkqcegzlzno-uhfffa...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 5-HYDROXYINDOLE_ACETATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-hydroxyindole acetate |
| + | * molecular-weight: | ||
| + | ** 190.178 | ||
| + | * inchi-key: | ||
| + | ** duugkqcegzlzno-uhfffaoysa-m | ||
| + | * smiles: | ||
| + | ** c([o-])(=o)cc1(=cnc2(c1=cc(o)=cc=2)) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-10780]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-hydroxyindole acetate}} |
| + | {{#set: molecular-weight=190.178}} | ||
| + | {{#set: inchi-key=inchikey=duugkqcegzlzno-uhfffaoysa-m}} | ||
Latest revision as of 19:34, 17 March 2021
Contents
Metabolite 5-HYDROXYINDOLE_ACETATE
- common-name:
- 5-hydroxyindole acetate
- molecular-weight:
- 190.178
- inchi-key:
- duugkqcegzlzno-uhfffaoysa-m
- smiles:
- c([o-])(=o)cc1(=cnc2(c1=cc(o)=cc=2))
