Difference between revisions of "5-HYDROXYINDOLE ACETATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11523 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa * molecular-weight: ** 1027.866 * inchi-...")
(Created page with "Category:metabolite == Metabolite 5-HYDROXYINDOLE_ACETATE == * common-name: ** 5-hydroxyindole acetate * molecular-weight: ** 190.178 * inchi-key: ** duugkqcegzlzno-uhfffa...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11523 ==
+
== Metabolite 5-HYDROXYINDOLE_ACETATE ==
 
* common-name:
 
* common-name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa
+
** 5-hydroxyindole acetate
 
* molecular-weight:
 
* molecular-weight:
** 1027.866
+
** 190.178
 
* inchi-key:
 
* inchi-key:
** omdqviuydjawhx-qhzcmhftsa-j
+
** duugkqcegzlzno-uhfffaoysa-m
 
* smiles:
 
* smiles:
** ccc=ccc1(c(ccc(=o)1)cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
+
** c([o-])(=o)cc1(=cnc2(c1=cc(o)=cc=2))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10702]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10704]]
+
* [[RXN-10780]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa}}
+
{{#set: common-name=5-hydroxyindole acetate}}
{{#set: molecular-weight=1027.866}}
+
{{#set: molecular-weight=190.178}}
{{#set: inchi-key=inchikey=omdqviuydjawhx-qhzcmhftsa-j}}
+
{{#set: inchi-key=inchikey=duugkqcegzlzno-uhfffaoysa-m}}

Latest revision as of 19:34, 17 March 2021

Metabolite 5-HYDROXYINDOLE_ACETATE

  • common-name:
    • 5-hydroxyindole acetate
  • molecular-weight:
    • 190.178
  • inchi-key:
    • duugkqcegzlzno-uhfffaoysa-m
  • smiles:
    • c([o-])(=o)cc1(=cnc2(c1=cc(o)=cc=2))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality