Difference between revisions of "5-HYDROXYINDOLE ACETATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CD-2S-SP-Complex == * common-name: ** a [cysteine desulfurase]-(s-sulfanyl)2-[disordered-form scaffold protein] complex == Reaction(s) kn...") |
(Created page with "Category:metabolite == Metabolite 5-HYDROXYINDOLE_ACETATE == * common-name: ** 5-hydroxyindole acetate * molecular-weight: ** 190.178 * inchi-key: ** duugkqcegzlzno-uhfffa...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 5-HYDROXYINDOLE_ACETATE == |
* common-name: | * common-name: | ||
− | ** | + | ** 5-hydroxyindole acetate |
+ | * molecular-weight: | ||
+ | ** 190.178 | ||
+ | * inchi-key: | ||
+ | ** duugkqcegzlzno-uhfffaoysa-m | ||
+ | * smiles: | ||
+ | ** c([o-])(=o)cc1(=cnc2(c1=cc(o)=cc=2)) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-10780]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=5-hydroxyindole acetate}} |
+ | {{#set: molecular-weight=190.178}} | ||
+ | {{#set: inchi-key=inchikey=duugkqcegzlzno-uhfffaoysa-m}} |
Latest revision as of 19:34, 17 March 2021
Contents
Metabolite 5-HYDROXYINDOLE_ACETATE
- common-name:
- 5-hydroxyindole acetate
- molecular-weight:
- 190.178
- inchi-key:
- duugkqcegzlzno-uhfffaoysa-m
- smiles:
- c([o-])(=o)cc1(=cnc2(c1=cc(o)=cc=2))