Difference between revisions of "1-AMINO-PROPAN-2-ONE-3-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DIAMINONONANOATE == * common-name: ** 7,8-diaminopelargonate * molecular-weight: ** 189.277 * inchi-key: ** kcegbpiygiwcdh-uhfffaoysa-o *...")
(Created page with "Category:metabolite == Metabolite 1-AMINO-PROPAN-2-ONE-3-PHOSPHATE == * common-name: ** 3-amino-1-hydroxyacetone 1-phosphate * molecular-weight: ** 168.066 * inchi-key: **...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite DIAMINONONANOATE ==
+
== Metabolite 1-AMINO-PROPAN-2-ONE-3-PHOSPHATE ==
 
* common-name:
 
* common-name:
−
** 7,8-diaminopelargonate
+
** 3-amino-1-hydroxyacetone 1-phosphate
 
* molecular-weight:
 
* molecular-weight:
−
** 189.277
+
** 168.066
 
* inchi-key:
 
* inchi-key:
−
** kcegbpiygiwcdh-uhfffaoysa-o
+
** hiqnvodxenyofk-uhfffaoysa-m
 
* smiles:
 
* smiles:
−
** cc(c(cccccc([o-])=o)[n+])[n+]
+
** c(c(=o)c[n+])op(=o)([o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[DAPASYN-RXN]]
+
* [[PDXJ-RXN]]
−
* [[DETHIOBIOTIN-SYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[DAPASYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=7,8-diaminopelargonate}}
+
{{#set: common-name=3-amino-1-hydroxyacetone 1-phosphate}}
−
{{#set: molecular-weight=189.277}}
+
{{#set: molecular-weight=168.066}}
−
{{#set: inchi-key=inchikey=kcegbpiygiwcdh-uhfffaoysa-o}}
+
{{#set: inchi-key=inchikey=hiqnvodxenyofk-uhfffaoysa-m}}

Latest revision as of 19:35, 17 March 2021

Metabolite 1-AMINO-PROPAN-2-ONE-3-PHOSPHATE

  • common-name:
    • 3-amino-1-hydroxyacetone 1-phosphate
  • molecular-weight:
    • 168.066
  • inchi-key:
    • hiqnvodxenyofk-uhfffaoysa-m
  • smiles:
    • c(c(=o)c[n+])op(=o)([o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=1-AMINO-PROPAN-2-ONE-3-PHOSPHATE&oldid=49278"