Difference between revisions of "1-AMINO-PROPAN-2-ONE-3-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9007 == * common_name: ** adp ribose 1'',2''-cyclic phosphate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o...")
 
(Created page with "Category:metabolite == Metabolite 1-AMINO-PROPAN-2-ONE-3-PHOSPHATE == * common-name: ** 3-amino-1-hydroxyacetone 1-phosphate * molecular-weight: ** 168.066 * inchi-key: **...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-9007 ==
+
== Metabolite 1-AMINO-PROPAN-2-ONE-3-PHOSPHATE ==
−
* common_name:
+
* common-name:
−
** adp ribose 1'',2''-cyclic phosphate
+
** 3-amino-1-hydroxyacetone 1-phosphate
 +
* molecular-weight:
 +
** 168.066
 +
* inchi-key:
 +
** hiqnvodxenyofk-uhfffaoysa-m
 
* smiles:
 
* smiles:
−
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o-])occ4(c(o)c5(op(=o)([o-])oc(o4)5)))([o-])=o
+
** c(c(=o)c[n+])op(=o)([o-])[o-]
−
* inchi_key:
 
−
** inchikey=npspryxpogpcpm-tyasjmozsa-k
 
−
* molecular_weight:
 
−
** 618.26   
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-12055]]
+
* [[PDXJ-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[2.7.1.160-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common_name=adp ribose 1'',2''-cyclic phosphate}}
+
{{#set: common-name=3-amino-1-hydroxyacetone 1-phosphate}}
−
{{#set: inchi_key=inchikey=npspryxpogpcpm-tyasjmozsa-k}}
+
{{#set: molecular-weight=168.066}}
−
{{#set: molecular_weight=618.26    }}
+
{{#set: inchi-key=inchikey=hiqnvodxenyofk-uhfffaoysa-m}}

Latest revision as of 19:35, 17 March 2021

Metabolite 1-AMINO-PROPAN-2-ONE-3-PHOSPHATE

  • common-name:
    • 3-amino-1-hydroxyacetone 1-phosphate
  • molecular-weight:
    • 168.066
  • inchi-key:
    • hiqnvodxenyofk-uhfffaoysa-m
  • smiles:
    • c(c(=o)c[n+])op(=o)([o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=1-AMINO-PROPAN-2-ONE-3-PHOSPHATE&oldid=49278"