Difference between revisions of "1-3-beta-D-Glucans"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11495 == * common-name: ** (2-hydroxyphenyl)acetate * molecular-weight: ** 151.141 * inchi-key: ** ccvyrrgzdbshfu-uhfffaoysa-m * smil...")
(Created page with "Category:metabolite == Metabolite 1-3-beta-D-Glucans == * common-name: ** a 1,3-β-d-glucan == Reaction(s) known to consume the compound == * 13-BETA-GLUCAN-SYNTHASE...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11495 ==
+
== Metabolite 1-3-beta-D-Glucans ==
 
* common-name:
 
* common-name:
** (2-hydroxyphenyl)acetate
+
** a 1,3-β-d-glucan
* molecular-weight:
 
** 151.141
 
* inchi-key:
 
** ccvyrrgzdbshfu-uhfffaoysa-m
 
* smiles:
 
** c(=o)([o-])cc1(=c(o)c=cc=c1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
 +
* [[3.2.1.39-RXN]]
 +
* [[3.2.1.58-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10815]]
+
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
 +
* [[3.2.1.39-RXN]]
 +
* [[3.2.1.58-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2-hydroxyphenyl)acetate}}
+
{{#set: common-name=a 1,3-β-d-glucan}}
{{#set: molecular-weight=151.141}}
 
{{#set: inchi-key=inchikey=ccvyrrgzdbshfu-uhfffaoysa-m}}
 

Latest revision as of 19:35, 17 March 2021

Metabolite 1-3-beta-D-Glucans

  • common-name:
    • a 1,3-β-d-glucan

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality