Difference between revisions of "18-HYDROXYOLEATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ACETALD == * common-name: ** acetaldehyde * molecular-weight: ** 44.053 * inchi-key: ** ikhguxgnuitlkf-uhfffaoysa-n * smiles: ** c[ch]=o...") |
(Created page with "Category:metabolite == Metabolite 18-HYDROXYOLEATE == * common-name: ** 18-hydroxyoleate * molecular-weight: ** 297.457 * inchi-key: ** lquhzvlttwmbto-uphrsurjsa-m * smile...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 18-HYDROXYOLEATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 18-hydroxyoleate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 297.457 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** lquhzvlttwmbto-uphrsurjsa-m |
* smiles: | * smiles: | ||
| − | ** c[ | + | ** c(o)cccccccc=ccccccccc(=o)[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16402]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=18-hydroxyoleate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=297.457}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lquhzvlttwmbto-uphrsurjsa-m}} |
Latest revision as of 19:35, 17 March 2021
Contents
Metabolite 18-HYDROXYOLEATE
- common-name:
- 18-hydroxyoleate
- molecular-weight:
- 297.457
- inchi-key:
- lquhzvlttwmbto-uphrsurjsa-m
- smiles:
- c(o)cccccccc=ccccccccc(=o)[o-]
