Difference between revisions of "ACETALD"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHE == * common-name: ** l-phenylalanine * molecular-weight: ** 165.191 * inchi-key: ** colnvldhvkwlrt-qmmmgpobsa-n * smiles: ** c([o-])(...")
(Created page with "Category:metabolite == Metabolite ACETALD == * common-name: ** acetaldehyde * molecular-weight: ** 44.053 * inchi-key: ** ikhguxgnuitlkf-uhfffaoysa-n * smiles: ** c[ch]=o...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHE ==
+
== Metabolite ACETALD ==
 
* common-name:
 
* common-name:
** l-phenylalanine
+
** acetaldehyde
 
* molecular-weight:
 
* molecular-weight:
** 165.191
+
** 44.053
 
* inchi-key:
 
* inchi-key:
** colnvldhvkwlrt-qmmmgpobsa-n
+
** ikhguxgnuitlkf-uhfffaoysa-n
 
* smiles:
 
* smiles:
** c([o-])(=o)c([n+])cc1(c=cc=cc=1)
+
** c[ch]=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.6.1.58-RXN]]
+
* [[ALCOHOL-DEHYDROG-RXN]]
* [[PHEAMINOTRANS-RXN]]
+
* [[RXN-12484]]
* [[PHENYLALANINE--TRNA-LIGASE-RXN]]
+
* [[RXN0-3962]]
* [[RXN-10814]]
+
* [[RXN66-3]]
* [[RXN-17130]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.6.1.58-RXN]]
+
* [[2-NITROPROPANE-DIOXYGENASE-RXN]]
* [[CARBOXYCYCLOHEXADIENYL-DEHYDRATASE-RXN]]
+
* [[ALCOHOL-DEHYDROG-RXN]]
* [[PHEAMINOTRANS-RXN]]
+
* [[LTAA-RXN]]
* [[RXN-10814]]
+
* [[RXN66-1]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-phenylalanine}}
+
{{#set: common-name=acetaldehyde}}
{{#set: molecular-weight=165.191}}
+
{{#set: molecular-weight=44.053}}
{{#set: inchi-key=inchikey=colnvldhvkwlrt-qmmmgpobsa-n}}
+
{{#set: inchi-key=inchikey=ikhguxgnuitlkf-uhfffaoysa-n}}

Latest revision as of 19:35, 17 March 2021

Metabolite ACETALD

  • common-name:
    • acetaldehyde
  • molecular-weight:
    • 44.053
  • inchi-key:
    • ikhguxgnuitlkf-uhfffaoysa-n
  • smiles:
    • c[ch]=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality