Difference between revisions of "4-Hydroxy-3-polyprenylbenzoates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-ALPHA-AMINO-EPSILON-KETO-PIMELATE == * common-name: ** l-α-amino-ε-keto-pimelate * molecular-weight: ** 188.16 * inchi-ke...")
(Created page with "Category:metabolite == Metabolite 4-Hydroxy-3-polyprenylbenzoates == * common-name: ** a 4-hydroxy-3-polyprenylbenzoate == Reaction(s) known to consume the compound == ==...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-ALPHA-AMINO-EPSILON-KETO-PIMELATE ==
+
== Metabolite 4-Hydroxy-3-polyprenylbenzoates ==
 
* common-name:
 
* common-name:
** l-α-amino-ε-keto-pimelate
+
** a 4-hydroxy-3-polyprenylbenzoate
* molecular-weight:
 
** 188.16
 
* inchi-key:
 
** ukcsfklwnhubdy-bypyzucnsa-m
 
* smiles:
 
** c([o-])(=o)c(cccc(c([o-])=o)=o)[n+]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-4821]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-4821]]
+
* [[RXN-11368]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-α-amino-ε-keto-pimelate}}
+
{{#set: common-name=a 4-hydroxy-3-polyprenylbenzoate}}
{{#set: molecular-weight=188.16}}
 
{{#set: inchi-key=inchikey=ukcsfklwnhubdy-bypyzucnsa-m}}
 

Latest revision as of 19:35, 17 March 2021

Metabolite 4-Hydroxy-3-polyprenylbenzoates

  • common-name:
    • a 4-hydroxy-3-polyprenylbenzoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality