Difference between revisions of "3-Oxo-octanoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MALTOTETRAOSE == * common-name: ** maltotetraose * molecular-weight: ** 666.583 * inchi-key: ** luewuzlmquobsb-ayqjavfrsa-n * smiles: **...")
(Created page with "Category:metabolite == Metabolite 3-Oxo-octanoyl-ACPs == * common-name: ** a 3-oxooctanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-14973 * RXN-95...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MALTOTETRAOSE ==
+
== Metabolite 3-Oxo-octanoyl-ACPs ==
 
* common-name:
 
* common-name:
** maltotetraose
+
** a 3-oxooctanoyl-[acp]
* molecular-weight:
 
** 666.583
 
* inchi-key:
 
** luewuzlmquobsb-ayqjavfrsa-n
 
* smiles:
 
** c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o)co))c(c2o)o)co))c(c3o)o)co))c(c(o)c4o)o))o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5182]]
+
* [[RXN-14973]]
 +
* [[RXN-9524]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLYMALTOPHOSPHORYL-RXN]]
+
* [[RXN-14972]]
* [[RXN-14284]]
+
* [[RXN-9523]]
 +
* [[RXN-9650]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=maltotetraose}}
+
{{#set: common-name=a 3-oxooctanoyl-[acp]}}
{{#set: molecular-weight=666.583}}
 
{{#set: inchi-key=inchikey=luewuzlmquobsb-ayqjavfrsa-n}}
 

Latest revision as of 19:35, 17 March 2021

Metabolite 3-Oxo-octanoyl-ACPs

  • common-name:
    • a 3-oxooctanoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 3-oxooctanoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.