Difference between revisions of "3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Cytochromes-c == * common-name: ** a c-type cytochrome == Reaction(s) known to consume the compound == * [[HOLOCYTOCHROME-C-SYNTHASE-RXN]...")
(Created page with "Category:metabolite == Metabolite 3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P == * common-name: ** 3-deoxy-d-arabino-heptulosonate 7-phosphate * molecular-weight: ** 285.124 * inc...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Cytochromes-c ==
+
== Metabolite 3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P ==
 
* common-name:
 
* common-name:
** a c-type cytochrome
+
** 3-deoxy-d-arabino-heptulosonate 7-phosphate
 +
* molecular-weight:
 +
** 285.124
 +
* inchi-key:
 +
** pjwipexiffqaqz-pufimzngsa-k
 +
* smiles:
 +
** c(=o)([o-])c(=o)cc(o)c(o)c(o)cop([o-])(=o)[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HOLOCYTOCHROME-C-SYNTHASE-RXN]]
+
* [[3-DEHYDROQUINATE-SYNTHASE-RXN]]
 +
* [[DAHPSYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HOLOCYTOCHROME-C-SYNTHASE-RXN]]
+
* [[DAHPSYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a c-type cytochrome}}
+
{{#set: common-name=3-deoxy-d-arabino-heptulosonate 7-phosphate}}
 +
{{#set: molecular-weight=285.124}}
 +
{{#set: inchi-key=inchikey=pjwipexiffqaqz-pufimzngsa-k}}

Latest revision as of 19:35, 17 March 2021

Metabolite 3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P

  • common-name:
    • 3-deoxy-d-arabino-heptulosonate 7-phosphate
  • molecular-weight:
    • 285.124
  • inchi-key:
    • pjwipexiffqaqz-pufimzngsa-k
  • smiles:
    • c(=o)([o-])c(=o)cc(o)c(o)c(o)cop([o-])(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality