Difference between revisions of "4-MALEYL-ACETOACETATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SULFOQUINOVOSYLDIACYLGLYCEROL == * common-name: ** an 6-sulfo-α-d-quinovosyl diacylglycerol == Reaction(s) known to consume the com...")
(Created page with "Category:metabolite == Metabolite 4-MALEYL-ACETOACETATE == * common-name: ** 4-maleyl-acetoacetate * molecular-weight: ** 198.132 * inchi-key: ** gacsivhaifqktc-uphrsurjsa...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SULFOQUINOVOSYLDIACYLGLYCEROL ==
+
== Metabolite 4-MALEYL-ACETOACETATE ==
 
* common-name:
 
* common-name:
** an 6-sulfo-α-d-quinovosyl diacylglycerol
+
** 4-maleyl-acetoacetate
 +
* molecular-weight:
 +
** 198.132
 +
* inchi-key:
 +
** gacsivhaifqktc-uphrsurjsa-l
 +
* smiles:
 +
** c([o-])(=o)c=cc(=o)cc(=o)cc([o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1224]]
+
* [[HOMOGENTISATE-12-DIOXYGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an 6-sulfo-α-d-quinovosyl diacylglycerol}}
+
{{#set: common-name=4-maleyl-acetoacetate}}
 +
{{#set: molecular-weight=198.132}}
 +
{{#set: inchi-key=inchikey=gacsivhaifqktc-uphrsurjsa-l}}

Latest revision as of 19:36, 17 March 2021

Metabolite 4-MALEYL-ACETOACETATE

  • common-name:
    • 4-maleyl-acetoacetate
  • molecular-weight:
    • 198.132
  • inchi-key:
    • gacsivhaifqktc-uphrsurjsa-l
  • smiles:
    • c([o-])(=o)c=cc(=o)cc(=o)cc([o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality