Difference between revisions of "1-CHLORO-24-DINITROBENZENE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SS-Oligoribonucleotides == * common-name: ** a single-stranded oligoribonucleotide == Reaction(s) known to consume the compound == == Rea...")
(Created page with "Category:metabolite == Metabolite 1-CHLORO-24-DINITROBENZENE == * common-name: ** 1-chloro-2,4-dinitrobenzene * molecular-weight: ** 202.554 * inchi-key: ** vyzahlcbvhpddf...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SS-Oligoribonucleotides ==
+
== Metabolite 1-CHLORO-24-DINITROBENZENE ==
 
* common-name:
 
* common-name:
** a single-stranded oligoribonucleotide
+
** 1-chloro-2,4-dinitrobenzene
 +
* molecular-weight:
 +
** 202.554
 +
* inchi-key:
 +
** vyzahlcbvhpddf-uhfffaoysa-n
 +
* smiles:
 +
** c1(c=c(cl)c(=cc=1[n+]([o-])=o)[n+]([o-])=o)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[GST-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.26.11-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a single-stranded oligoribonucleotide}}
+
{{#set: common-name=1-chloro-2,4-dinitrobenzene}}
 +
{{#set: molecular-weight=202.554}}
 +
{{#set: inchi-key=inchikey=vyzahlcbvhpddf-uhfffaoysa-n}}

Latest revision as of 19:36, 17 March 2021

Metabolite 1-CHLORO-24-DINITROBENZENE

  • common-name:
    • 1-chloro-2,4-dinitrobenzene
  • molecular-weight:
    • 202.554
  • inchi-key:
    • vyzahlcbvhpddf-uhfffaoysa-n
  • smiles:
    • c1(c=c(cl)c(=cc=1[n+]([o-])=o)[n+]([o-])=o)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality