Difference between revisions of "GLY-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N2-ACETYL-ALPHA-AMIN == * common-name: ** n2-acetyl-α-aminoadipate * molecular-weight: ** 201.179 * inchi-key: ** fttgaazkbnzdcz-lu...")
(Created page with "Category:metabolite == Metabolite GLY-tRNAs == * common-name: ** a trnagly == Reaction(s) known to consume the compound == * GLYCINE--TRNA-LIGASE-RXN == Reaction(s) kn...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N2-ACETYL-ALPHA-AMIN ==
+
== Metabolite GLY-tRNAs ==
 
* common-name:
 
* common-name:
** n2-acetyl-α-aminoadipate
+
** a trnagly
* molecular-weight:
 
** 201.179
 
* inchi-key:
 
** fttgaazkbnzdcz-lurjtmiesa-l
 
* smiles:
 
** cc(=o)nc(cccc(=o)[o-])c(=o)[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-5181]]
+
* [[GLYCINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-5181]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n2-acetyl-α-aminoadipate}}
+
{{#set: common-name=a trnagly}}
{{#set: molecular-weight=201.179}}
 
{{#set: inchi-key=inchikey=fttgaazkbnzdcz-lurjtmiesa-l}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite GLY-tRNAs

  • common-name:
    • a trnagly

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality