Difference between revisions of "3-oxo-petroselinoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18489 == * common-name: ** (3r,9z,12z,15z,18z)-3-hydroxytetracosatetraenoyl-coa * molecular-weight: ** 1122.065 * inchi-key: ** dmysj...")
(Created page with "Category:metabolite == Metabolite 3-oxo-petroselinoyl-ACPs == * common-name: ** a (6z)-3-oxooctadec-6-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18489 ==
+
== Metabolite 3-oxo-petroselinoyl-ACPs ==
 
* common-name:
 
* common-name:
** (3r,9z,12z,15z,18z)-3-hydroxytetracosatetraenoyl-coa
+
** a (6z)-3-oxooctadec-6-enoyl-[acp]
* molecular-weight:
 
** 1122.065
 
* inchi-key:
 
** dmysjgjjptxmaw-jjkiljmssa-j
 
* smiles:
 
** cccccc=ccc=ccc=ccc=ccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-9552]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17109]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3r,9z,12z,15z,18z)-3-hydroxytetracosatetraenoyl-coa}}
+
{{#set: common-name=a (6z)-3-oxooctadec-6-enoyl-[acp]}}
{{#set: molecular-weight=1122.065}}
 
{{#set: inchi-key=inchikey=dmysjgjjptxmaw-jjkiljmssa-j}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite 3-oxo-petroselinoyl-ACPs

  • common-name:
    • a (6z)-3-oxooctadec-6-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (6z)-3-oxooctadec-6-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.