Difference between revisions of "LYS-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ANTHRANILATE == * common-name: ** anthranilate * molecular-weight: ** 136.13 * inchi-key: ** rwzyaggxghygmb-uhfffaoysa-m * smiles: ** c(c...")
(Created page with "Category:metabolite == Metabolite LYS-tRNAs == * common-name: ** a trnalys == Reaction(s) known to consume the compound == * LYSINE--TRNA-LIGASE-RXN == Reaction(s) kno...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ANTHRANILATE ==
+
== Metabolite LYS-tRNAs ==
 
* common-name:
 
* common-name:
** anthranilate
+
** a trnalys
* molecular-weight:
 
** 136.13
 
* inchi-key:
 
** rwzyaggxghygmb-uhfffaoysa-m
 
* smiles:
 
** c(c1(c(=cc=cc=1)n))(=o)[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ANTHRANSYN-RXN]]
+
* [[LYSINE--TRNA-LIGASE-RXN]]
* [[PRTRANS-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ANTHRANSYN-RXN]]
 
* [[PRTRANS-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=anthranilate}}
+
{{#set: common-name=a trnalys}}
{{#set: molecular-weight=136.13}}
 
{{#set: inchi-key=inchikey=rwzyaggxghygmb-uhfffaoysa-m}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite LYS-tRNAs

  • common-name:
    • a trnalys

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality