Difference between revisions of "PRO-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-730 == * common-name: ** 8-[(1r,2r)-3-oxo-2-{(z)-pent-2-enyl}cyclopentyl]octanoate * molecular-weight: ** 293.425 * inchi-key: ** bzx...")
(Created page with "Category:metabolite == Metabolite PRO-tRNAs == * common-name: ** a trnapro == Reaction(s) known to consume the compound == * PROLINE--TRNA-LIGASE-RXN == Reaction(s) kn...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-730 ==
+
== Metabolite PRO-tRNAs ==
 
* common-name:
 
* common-name:
** 8-[(1r,2r)-3-oxo-2-{(z)-pent-2-enyl}cyclopentyl]octanoate
+
** a trnapro
* molecular-weight:
 
** 293.425
 
* inchi-key:
 
** bzxzfdkirzbjep-jmtmcxqrsa-m
 
* smiles:
 
** ccc=ccc1(c(ccc(=o)1)cccccccc([o-])=o)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[PROLINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[12-OXOPHYTODIENOATE-REDUCTASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=8-[(1r,2r)-3-oxo-2-{(z)-pent-2-enyl}cyclopentyl]octanoate}}
+
{{#set: common-name=a trnapro}}
{{#set: molecular-weight=293.425}}
 
{{#set: inchi-key=inchikey=bzxzfdkirzbjep-jmtmcxqrsa-m}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite PRO-tRNAs

  • common-name:
    • a trnapro

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality