Difference between revisions of "PRO-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-129 == * common-name: ** β-carotene * molecular-weight: ** 536.882 * inchi-key: ** oenhqhleoonyie-jltxgrslsa-n * smiles: ** cc...")
(Created page with "Category:metabolite == Metabolite PRO-tRNAs == * common-name: ** a trnapro == Reaction(s) known to consume the compound == * PROLINE--TRNA-LIGASE-RXN == Reaction(s) kn...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1F-129 ==
+
== Metabolite PRO-tRNAs ==
 
* common-name:
 
* common-name:
** β-carotene
+
** a trnapro
* molecular-weight:
 
** 536.882
 
* inchi-key:
 
** oenhqhleoonyie-jltxgrslsa-n
 
* smiles:
 
** cc(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)=cc=cc=c(c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c)c
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[PROLINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1F-151]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-carotene}}
+
{{#set: common-name=a trnapro}}
{{#set: molecular-weight=536.882}}
 
{{#set: inchi-key=inchikey=oenhqhleoonyie-jltxgrslsa-n}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite PRO-tRNAs

  • common-name:
    • a trnapro

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality