Difference between revisions of "3-terminal-unsaturated-sugars"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CH33ADO == * common-name: ** 5'-deoxyadenosine * molecular-weight: ** 251.244 * inchi-key: ** xgyimtfotbmpfp-kqynxxcusa-n * smiles: ** cc...")
(Created page with "Category:metabolite == Metabolite 3-terminal-unsaturated-sugars == * common-name: ** a 3'-terminal unsaturated sugar == Reaction(s) known to consume the compound == == Rea...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CH33ADO ==
+
== Metabolite 3-terminal-unsaturated-sugars ==
 
* common-name:
 
* common-name:
** 5'-deoxyadenosine
+
** a 3'-terminal unsaturated sugar
* molecular-weight:
 
** 251.244
 
* inchi-key:
 
** xgyimtfotbmpfp-kqynxxcusa-n
 
* smiles:
 
** cc1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.8.1.6-RXN]]
+
* [[4.2.99.18-RXN]]
* [[HEMN-RXN]]
 
* [[RXN-14950]]
 
* [[RXN-14957]]
 
* [[RXN-14959]]
 
* [[RXN-17472]]
 
* [[RXN-17473]]
 
* [[RXN0-949]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5'-deoxyadenosine}}
+
{{#set: common-name=a 3'-terminal unsaturated sugar}}
{{#set: molecular-weight=251.244}}
 
{{#set: inchi-key=inchikey=xgyimtfotbmpfp-kqynxxcusa-n}}
 

Latest revision as of 19:37, 17 March 2021

Metabolite 3-terminal-unsaturated-sugars

  • common-name:
    • a 3'-terminal unsaturated sugar

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality