Difference between revisions of "ADENOSYLCOBINAMIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-676 == * common-name: ** trans-caffeate * molecular-weight: ** 179.152 * inchi-key: ** qaiprvgongvqas-duxpyhpusa-m * smiles: ** c([o-...")
(Created page with "Category:metabolite == Metabolite ADENOSYLCOBINAMIDE == * common-name: ** adenosylcobinamide * molecular-weight: ** 1240.332 * inchi-key: ** kqxspgaebzwhmc-qmuwongrsa-m *...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-676 ==
+
== Metabolite ADENOSYLCOBINAMIDE ==
 
* common-name:
 
* common-name:
** trans-caffeate
+
** adenosylcobinamide
 
* molecular-weight:
 
* molecular-weight:
** 179.152
+
** 1240.332
 
* inchi-key:
 
* inchi-key:
** qaiprvgongvqas-duxpyhpusa-m
+
** kqxspgaebzwhmc-qmuwongrsa-m
 
* smiles:
 
* smiles:
** c([o-])(=o)c=cc1(c=c(o)c(o)=cc=1)
+
** cc(o)cnc(=o)ccc5(c)(c(cc(=o)n)c7(c%11(c)(c(c)(cc(n)=o)c(ccc(n)=o)c1(=[n+]([co--]26([n+]4(c(=cc3(c(ccc(n)=o)c(c)(cc(n)=o)c(=c(c)1)[n+]2=3))c(c)(c)c(ccc(n)=o)c=4c(c)=c5n67))(cc8(c(c(o)c(o8)n9(c=nc%10(=c9n=cn=c%10n)))o)))%11))))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-1126]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[BTUR2-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-caffeate}}
+
{{#set: common-name=adenosylcobinamide}}
{{#set: molecular-weight=179.152}}
+
{{#set: molecular-weight=1240.332}}
{{#set: inchi-key=inchikey=qaiprvgongvqas-duxpyhpusa-m}}
+
{{#set: inchi-key=inchikey=kqxspgaebzwhmc-qmuwongrsa-m}}

Latest revision as of 19:37, 17 March 2021

Metabolite ADENOSYLCOBINAMIDE

  • common-name:
    • adenosylcobinamide
  • molecular-weight:
    • 1240.332
  • inchi-key:
    • kqxspgaebzwhmc-qmuwongrsa-m
  • smiles:
    • cc(o)cnc(=o)ccc5(c)(c(cc(=o)n)c7(c%11(c)(c(c)(cc(n)=o)c(ccc(n)=o)c1(=[n+]([co--]26([n+]4(c(=cc3(c(ccc(n)=o)c(c)(cc(n)=o)c(=c(c)1)[n+]2=3))c(c)(c)c(ccc(n)=o)c=4c(c)=c5n67))(cc8(c(c(o)c(o8)n9(c=nc%10(=c9n=cn=c%10n)))o)))%11))))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality