Difference between revisions of "Heme-b"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14602 == * common-name: ** mycophenolic acid o-acyl-glucuronide * molecular-weight: ** 495.459 * inchi-key: ** qbmstezxamabff-uearnrk...")
(Created page with "Category:metabolite == Metabolite Heme-b == * common-name: ** heme b == Reaction(s) known to consume the compound == * 3.6.3.41-RXN == Reaction(s) known to produce the...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14602 ==
+
== Metabolite Heme-b ==
 
* common-name:
 
* common-name:
** mycophenolic acid o-acyl-glucuronide
+
** heme b
* molecular-weight:
 
** 495.459
 
* inchi-key:
 
** qbmstezxamabff-uearnrkisa-m
 
* smiles:
 
** cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(o)2)3))oc)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.6.3.41-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13607]]
+
* [[3.6.3.41-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=mycophenolic acid o-acyl-glucuronide}}
+
{{#set: common-name=heme b}}
{{#set: molecular-weight=495.459}}
 
{{#set: inchi-key=inchikey=qbmstezxamabff-uearnrkisa-m}}
 

Latest revision as of 19:37, 17 March 2021

Metabolite Heme-b

  • common-name:
    • heme b

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality