Difference between revisions of "APS"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-KETO-ADIPYL-COA == * common-name: ** 3-oxoadipyl-coa * molecular-weight: ** 904.605 * inchi-key: ** vkkkaapgxhwxoo-biewrjsysa-i * smile...") |
(Created page with "Category:metabolite == Metabolite APS == * common-name: ** adenosine 5'-phosphosulfate * molecular-weight: ** 425.266 * inchi-key: ** irlpacmltupbcl-kqynxxcusa-l * smiles:...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite APS == |
* common-name: | * common-name: | ||
− | ** | + | ** adenosine 5'-phosphosulfate |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 425.266 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** irlpacmltupbcl-kqynxxcusa-l |
* smiles: | * smiles: | ||
− | ** | + | ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(os(=o)([o-])=o)([o-])=o |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ADENYLYLSULFATASE-RXN]] |
+ | * [[ADENYLYLSULFATE-REDUCTASE-RXN]] | ||
+ | * [[ADENYLYLSULFKIN-RXN]] | ||
+ | * [[R163-RXN]] | ||
+ | * [[SULFATE-ADENYLYLTRANS-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ADENYLYLSULFATE-REDUCTASE-RXN]] |
+ | * [[ADENYLYLSULFKIN-RXN]] | ||
+ | * [[R163-RXN]] | ||
+ | * [[SULFATE-ADENYLYLTRANS-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=adenosine 5'-phosphosulfate}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=425.266}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=irlpacmltupbcl-kqynxxcusa-l}} |
Latest revision as of 19:34, 17 March 2021
Contents
Metabolite APS
- common-name:
- adenosine 5'-phosphosulfate
- molecular-weight:
- 425.266
- inchi-key:
- irlpacmltupbcl-kqynxxcusa-l
- smiles:
- c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(os(=o)([o-])=o)([o-])=o
Reaction(s) known to consume the compound
- ADENYLYLSULFATASE-RXN
- ADENYLYLSULFATE-REDUCTASE-RXN
- ADENYLYLSULFKIN-RXN
- R163-RXN
- SULFATE-ADENYLYLTRANS-RXN