Difference between revisions of "16S-rRNA-N2-methylguanine1207"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18494 == * common-name: ** (6z,9z,12z,15z,18z)-3-oxotetracosapentaenoyl-coa * molecular-weight: ** 1118.034 * inchi-key: ** uiagujimv...")
(Created page with "Category:metabolite == Metabolite CPD-7670 == * common-name: ** dimethyl sulfide * molecular-weight: ** 62.129 * inchi-key: ** qmmfvypahwmcms-uhfffaoysa-n * smiles: ** csc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18494 ==
+
== Metabolite CPD-7670 ==
 
* common-name:
 
* common-name:
** (6z,9z,12z,15z,18z)-3-oxotetracosapentaenoyl-coa
+
** dimethyl sulfide
 
* molecular-weight:
 
* molecular-weight:
** 1118.034
+
** 62.129
 
* inchi-key:
 
* inchi-key:
** uiagujimvqpsdp-qojzhlsosa-j
+
** qmmfvypahwmcms-uhfffaoysa-n
 
* smiles:
 
* smiles:
** cccccc=ccc=ccc=ccc=ccc=cccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** csc
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17116]]
+
* [[2.1.1.19-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17115]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(6z,9z,12z,15z,18z)-3-oxotetracosapentaenoyl-coa}}
+
{{#set: common-name=dimethyl sulfide}}
{{#set: molecular-weight=1118.034}}
+
{{#set: molecular-weight=62.129}}
{{#set: inchi-key=inchikey=uiagujimvqpsdp-qojzhlsosa-j}}
+
{{#set: inchi-key=inchikey=qmmfvypahwmcms-uhfffaoysa-n}}

Revision as of 18:59, 17 March 2021

Metabolite CPD-7670

  • common-name:
    • dimethyl sulfide
  • molecular-weight:
    • 62.129
  • inchi-key:
    • qmmfvypahwmcms-uhfffaoysa-n
  • smiles:
    • csc

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality