Difference between revisions of "B-ALANINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite FeS-Cluster-Co-Chaperones == * common-name: ** an [fe-s cluster biosynthesis co-chaperone] == Reaction(s) known to consume the compound =...")
(Created page with "Category:metabolite == Metabolite MANNITOL-1P == * common-name: ** d-mannitol 1-phosphate * molecular-weight: ** 260.137 * inchi-key: ** gactwzzmvmukng-kvtdhhqdsa-l * smil...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite FeS-Cluster-Co-Chaperones ==
+
== Metabolite MANNITOL-1P ==
 
* common-name:
 
* common-name:
** an [fe-s cluster biosynthesis co-chaperone]
+
** d-mannitol 1-phosphate
 +
* molecular-weight:
 +
** 260.137
 +
* inchi-key:
 +
** gactwzzmvmukng-kvtdhhqdsa-l
 +
* smiles:
 +
** c(c(c(c(c(cop([o-])([o-])=o)o)o)o)o)o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14388]]
+
* [[MANNITOL-1-PHOSPHATASE-RXN]]
 +
* [[MANNPDEHYDROG-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14390]]
+
* [[MANNPDEHYDROG-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an [fe-s cluster biosynthesis co-chaperone]}}
+
{{#set: common-name=d-mannitol 1-phosphate}}
 +
{{#set: molecular-weight=260.137}}
 +
{{#set: inchi-key=inchikey=gactwzzmvmukng-kvtdhhqdsa-l}}

Revision as of 18:59, 17 March 2021

Metabolite MANNITOL-1P

  • common-name:
    • d-mannitol 1-phosphate
  • molecular-weight:
    • 260.137
  • inchi-key:
    • gactwzzmvmukng-kvtdhhqdsa-l
  • smiles:
    • c(c(c(c(c(cop([o-])([o-])=o)o)o)o)o)o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality