Difference between revisions of "2E-7Z-hexadeca-2-7-dienoyl-ACPs"

Revision as of 18:59, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-8646 ==
+== Metabolite 3-7-DIMETHYLXANTHINE ==
 * common-name:
-** 7-dehydrodesmosterol
+** theobromine
+* molecular-weight:
+** 180.166
 * inchi-key:
-** russpkpuxdshnc-ddpqnldtsa-n
+** yapqbxqyljrxsa-uhfffaoysa-n
-* molecular-weight:
-** 382.628
 * smiles:
-** cc(c)=ccc[c@@h](c)[c@h]1(cc[c@@h]4([c@@](c)1cc[c@h]3([c@]2(c)(c(/c[c@@h](o)cc2)=c/c=c34))))
+** cn2(c=nc1(=c(c(nc(n(c)1)=o)=o)2))
 == Reaction(s) known to consume the compound ==
+* [[RXN-11519]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-11887]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=7-dehydrodesmosterol}}
+{{#set: common-name=theobromine}}
-{{#set: inchi-key=inchikey=russpkpuxdshnc-ddpqnldtsa-n}}
+{{#set: molecular-weight=180.166}}
-{{#set: molecular-weight=382.628}}
+{{#set: inchi-key=inchikey=yapqbxqyljrxsa-uhfffaoysa-n}}