Difference between revisions of "MALONYL-ACP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6992 == * common-name: ** (+)-pinobanksin * molecular-weight: ** 271.249 * inchi-key: ** suyjzkrqhbqnca-lsdhhaiusa-m * smiles: ** c3(...")
(Created page with "Category:metabolite == Metabolite medium-Chain-Trans-23-Dehydroacyl-CoA == * common-name: ** a medium-chain trans-2,3-dehydroacyl-coa == Reaction(s) known to consume the c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-6992 ==
+
== Metabolite medium-Chain-Trans-23-Dehydroacyl-CoA ==
 
* common-name:
 
* common-name:
** (+)-pinobanksin
+
** a medium-chain trans-2,3-dehydroacyl-coa
* molecular-weight:
 
** 271.249
 
* inchi-key:
 
** suyjzkrqhbqnca-lsdhhaiusa-m
 
* smiles:
 
** c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2o)=o)o)[o-])))=cc=3)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7648]]
+
* [[RXN-11734]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(+)-pinobanksin}}
+
{{#set: common-name=a medium-chain trans-2,3-dehydroacyl-coa}}
{{#set: molecular-weight=271.249}}
 
{{#set: inchi-key=inchikey=suyjzkrqhbqnca-lsdhhaiusa-m}}
 

Revision as of 18:59, 17 March 2021

Metabolite medium-Chain-Trans-23-Dehydroacyl-CoA

  • common-name:
    • a medium-chain trans-2,3-dehydroacyl-coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality