Difference between revisions of "9Z-3-oxo-octadec-9-enoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Lipoyl-Protein-L-Lysine == * common-name: ** a [lipoyl-carrier protein]-l-lysine == Reaction(s) known to consume the compound == * RXN0...") |
(Created page with "Category:metabolite == Metabolite UDP-SULFOQUINOVOSE == * common-name: ** udp-α-d-sulfoquinovopyranose * molecular-weight: ** 627.34 * inchi-key: ** fqancgqcbcusmi-j...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite UDP-SULFOQUINOVOSE == |
* common-name: | * common-name: | ||
− | ** | + | ** udp-α-d-sulfoquinovopyranose |
+ | * molecular-weight: | ||
+ | ** 627.34 | ||
+ | * inchi-key: | ||
+ | ** fqancgqcbcusmi-jzmiexbbsa-k | ||
+ | * smiles: | ||
+ | ** c(op(=o)([o-])op(=o)(oc1(oc(cs(=o)(=o)[o-])c(o)c(o)c(o)1))[o-])c2(c(o)c(o)c(o2)n3(c=cc(=o)nc(=o)3)) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-1224]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-1223]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=udp-α-d-sulfoquinovopyranose}} |
+ | {{#set: molecular-weight=627.34}} | ||
+ | {{#set: inchi-key=inchikey=fqancgqcbcusmi-jzmiexbbsa-k}} |
Revision as of 19:00, 17 March 2021
Contents
Metabolite UDP-SULFOQUINOVOSE
- common-name:
- udp-α-d-sulfoquinovopyranose
- molecular-weight:
- 627.34
- inchi-key:
- fqancgqcbcusmi-jzmiexbbsa-k
- smiles:
- c(op(=o)([o-])op(=o)(oc1(oc(cs(=o)(=o)[o-])c(o)c(o)c(o)1))[o-])c2(c(o)c(o)c(o2)n3(c=cc(=o)nc(=o)3))