Difference between revisions of "5Z-tetradec-5-enoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15675 == * common-name: ** 2-trans-6-trans-tridecadienoyl-coa * molecular-weight: ** 955.803 * inchi-key: ** oosdlbaxvxkfib-bjbrngjvs...") |
(Created page with "Category:metabolite == Metabolite CPD-17365 == * common-name: ** (4z,7z,10z,13z,16z)-docosapentaenoyl-coa * molecular-weight: ** 1075.997 * inchi-key: ** qkbtyzdpvnterq-uw...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-17365 == |
* common-name: | * common-name: | ||
− | ** | + | ** (4z,7z,10z,13z,16z)-docosapentaenoyl-coa |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 1075.997 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** qkbtyzdpvnterq-uwvcyphhsa-j |
* smiles: | * smiles: | ||
− | ** | + | ** cccccc=ccc=ccc=ccc=ccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-17116]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(4z,7z,10z,13z,16z)-docosapentaenoyl-coa}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=1075.997}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qkbtyzdpvnterq-uwvcyphhsa-j}} |
Revision as of 19:01, 17 March 2021
Contents
Metabolite CPD-17365
- common-name:
- (4z,7z,10z,13z,16z)-docosapentaenoyl-coa
- molecular-weight:
- 1075.997
- inchi-key:
- qkbtyzdpvnterq-uwvcyphhsa-j
- smiles:
- cccccc=ccc=ccc=ccc=ccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]