Difference between revisions of "3-P-HYDROXYPYRUVATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GALACTOSE-1P == * common-name: ** α-d-galactose 1-phosphate * molecular-weight: ** 258.121 * inchi-key: ** hxxfsfrbohsimq-fprjbglds...")
(Created page with "Category:metabolite == Metabolite Cis-vaccenoyl-ACPs == * common-name: ** a cis-vaccenoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9555 == Reaction(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GALACTOSE-1P ==
+
== Metabolite Cis-vaccenoyl-ACPs ==
 
* common-name:
 
* common-name:
** α-d-galactose 1-phosphate
+
** a cis-vaccenoyl-[acp]
* molecular-weight:
 
** 258.121
 
* inchi-key:
 
** hxxfsfrbohsimq-fprjbgldsa-l
 
* smiles:
 
** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GALACTOKIN-RXN]]
+
* [[RXN-9555]]
* [[GALACTURIDYLYLTRANS-RXN]]
 
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GALACTOKIN-RXN]]
+
* [[RXN-9558]]
* [[GALACTURIDYLYLTRANS-RXN]]
 
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-d-galactose 1-phosphate}}
+
{{#set: common-name=a cis-vaccenoyl-[acp]}}
{{#set: molecular-weight=258.121}}
 
{{#set: inchi-key=inchikey=hxxfsfrbohsimq-fprjbgldsa-l}}
 

Revision as of 19:01, 17 March 2021

Metabolite Cis-vaccenoyl-ACPs

  • common-name:
    • a cis-vaccenoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a cis-vaccenoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.