Difference between revisions of "ALL-TRANS-HEXAPRENYL-DIPHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ADENOSYL-P4 == * common-name: ** p1,p4-bis(5'-adenosyl) tetraphosphate * molecular-weight: ** 832.36 * inchi-key: ** yoahknvsncmzgq-xpwfq...") |
(Created page with "Category:metabolite == Metabolite L-GLUTAMATE-5-P == * common-name: ** γ-l-glutamyl 5-phosphate * molecular-weight: ** 225.094 * inchi-key: ** pjrxvijaernuip-vkhmyhe...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite L-GLUTAMATE-5-P == |
* common-name: | * common-name: | ||
− | ** | + | ** γ-l-glutamyl 5-phosphate |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 225.094 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** pjrxvijaernuip-vkhmyheasa-l |
* smiles: | * smiles: | ||
− | ** c( | + | ** c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[GLUTSEMIALDEHYDROG-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[GLUTKIN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=γ-l-glutamyl 5-phosphate}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=225.094}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pjrxvijaernuip-vkhmyheasa-l}} |
Revision as of 19:01, 17 March 2021
Contents
Metabolite L-GLUTAMATE-5-P
- common-name:
- γ-l-glutamyl 5-phosphate
- molecular-weight:
- 225.094
- inchi-key:
- pjrxvijaernuip-vkhmyheasa-l
- smiles:
- c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o