Difference between revisions of "5-HYDROXY-TRYPTOPHAN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-METHYLTHIOADENOSINE == * common-name: ** s-methyl-5'-thioadenosine * molecular-weight: ** 297.331 * inchi-key: ** wuugfsxjnotrmr-ioslpc...") |
(Created page with "Category:metabolite == Metabolite 1-AMINO-PROPAN-2-ONE-3-PHOSPHATE == * common-name: ** 3-amino-1-hydroxyacetone 1-phosphate * molecular-weight: ** 168.066 * inchi-key: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 1-AMINO-PROPAN-2-ONE-3-PHOSPHATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-amino-1-hydroxyacetone 1-phosphate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 168.066 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hiqnvodxenyofk-uhfffaoysa-m |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c(=o)c[n+])op(=o)([o-])[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[PDXJ-RXN]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-amino-1-hydroxyacetone 1-phosphate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=168.066}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hiqnvodxenyofk-uhfffaoysa-m}} |
Revision as of 19:01, 17 March 2021
Contents
Metabolite 1-AMINO-PROPAN-2-ONE-3-PHOSPHATE
- common-name:
- 3-amino-1-hydroxyacetone 1-phosphate
- molecular-weight:
- 168.066
- inchi-key:
- hiqnvodxenyofk-uhfffaoysa-m
- smiles:
- c(c(=o)c[n+])op(=o)([o-])[o-]
