Difference between revisions of "A-2-oxoglutarate-dehydrogenase-E2-protei"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UDP-N-ACETYL-D-GLUCOSAMINE == * common-name: ** udp-n-acetyl-α-d-glucosamine * molecular-weight: ** 605.342 * inchi-key: ** lftytua...")
(Created page with "Category:metabolite == Metabolite CPD-17332 == * common-name: ** (9z,12z,15z,18z,21z)-3-oxotetracosapentaenoyl-coa * molecular-weight: ** 1118.034 * inchi-key: ** uqpanogf...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite UDP-N-ACETYL-D-GLUCOSAMINE ==
+
== Metabolite CPD-17332 ==
 
* common-name:
 
* common-name:
−
** udp-n-acetyl-α-d-glucosamine
+
** (9z,12z,15z,18z,21z)-3-oxotetracosapentaenoyl-coa
 
* molecular-weight:
 
* molecular-weight:
−
** 605.342
+
** 1118.034
 
* inchi-key:
 
* inchi-key:
−
** lftytuazoprmmi-cfrasdgpsa-l
+
** uqpanogfyczrav-afqbpcmksa-j
 
* smiles:
 
* smiles:
−
** cc(=o)nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(nc2=o)=o))o)o))([o-])=o)([o-])=o)oc(c(c3o)o)co)
+
** ccc=ccc=ccc=ccc=ccc=ccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[2.4.1.101-RXN]]
+
* [[RXN-16129]]
−
* [[2.4.1.141-RXN]]
 
−
* [[2.4.1.143-RXN]]
 
−
* [[2.4.1.144-RXN]]
 
−
* [[2.4.1.145-RXN]]
 
−
* [[2.4.1.149-RXN]]
 
−
* [[2.4.1.150-RXN]]
 
−
* [[2.4.1.155-RXN]]
 
−
* [[2.4.1.198-RXN]]
 
−
* [[2.4.1.201-RXN]]
 
−
* [[2.4.1.224-RXN]]
 
−
* [[2.4.1.229-RXN]]
 
−
* [[2.4.1.94-RXN]]
 
−
* [[2.7.8.15-RXN]]
 
−
* [[RXN-15277]]
 
−
* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[2.4.1.198-RXN]]
+
* [[RXN-16082]]
−
* [[2.4.1.94-RXN]]
 
−
* [[NAG1P-URIDYLTRANS-RXN]]
 
−
* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=udp-n-acetyl-α-d-glucosamine}}
+
{{#set: common-name=(9z,12z,15z,18z,21z)-3-oxotetracosapentaenoyl-coa}}
−
{{#set: molecular-weight=605.342}}
+
{{#set: molecular-weight=1118.034}}
−
{{#set: inchi-key=inchikey=lftytuazoprmmi-cfrasdgpsa-l}}
+
{{#set: inchi-key=inchikey=uqpanogfyczrav-afqbpcmksa-j}}

Revision as of 19:02, 17 March 2021

Metabolite CPD-17332

  • common-name:
    • (9z,12z,15z,18z,21z)-3-oxotetracosapentaenoyl-coa
  • molecular-weight:
    • 1118.034
  • inchi-key:
    • uqpanogfyczrav-afqbpcmksa-j
  • smiles:
    • ccc=ccc=ccc=ccc=ccc=ccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=A-2-oxoglutarate-dehydrogenase-E2-protei&oldid=39050"