Difference between revisions of "1-INDANOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDROXYPHENYLGLYCOLALDEHYDE == * common-name: ** 3,4-dihydroxyphenylglycolaldehyde * molecular-weight: ** 168.149 * inchi-key: ** yugmc...") |
(Created page with "Category:metabolite == Metabolite N-ACETYL-BETA-GLUCOSAMINYLAMINE == * common-name: ** n-acetyl-β-glucosaminylamine * molecular-weight: ** 220.225 * inchi-key: ** mcg...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-ACETYL-BETA-GLUCOSAMINYLAMINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-acetyl-β-glucosaminylamine |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 220.225 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mcgxocxffnkasf-fmdgeedcsa-n |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=o)nc1(c(n)oc(co)c(o)c(o)1) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[3.5.1.26-RXN]] | ||
| + | * [[3.5.1.52-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-acetyl-β-glucosaminylamine}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=220.225}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mcgxocxffnkasf-fmdgeedcsa-n}} |
Revision as of 19:02, 17 March 2021
Contents
Metabolite N-ACETYL-BETA-GLUCOSAMINYLAMINE
- common-name:
- n-acetyl-β-glucosaminylamine
- molecular-weight:
- 220.225
- inchi-key:
- mcgxocxffnkasf-fmdgeedcsa-n
- smiles:
- cc(=o)nc1(c(n)oc(co)c(o)c(o)1)
