Difference between revisions of "TRIMETHYLSULFONIUM"

Latest revision as of 19:32, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-19151 ==
+== Metabolite TRIMETHYLSULFONIUM ==
 * common-name:
-** (s)-3-hydroxy-(5z)-dodecenoyl-coa
+** trimethyl sulfonium
 * molecular-weight:
-** 959.791
+** 77.164
 * inchi-key:
-** ayordfmyybnsbo-qccsjadrsa-j
+** nrzwqkgabzffke-uhfffaoysa-n
 * smiles:
-** ccccccc=ccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+** c[s+](c)c
 == Reaction(s) known to consume the compound ==
-* [[RXN-17798]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-17797]]
+* [[2.1.1.19-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(s)-3-hydroxy-(5z)-dodecenoyl-coa}}
+{{#set: common-name=trimethyl sulfonium}}
-{{#set: molecular-weight=959.791}}
+{{#set: molecular-weight=77.164}}
-{{#set: inchi-key=inchikey=ayordfmyybnsbo-qccsjadrsa-j}}
+{{#set: inchi-key=inchikey=nrzwqkgabzffke-uhfffaoysa-n}}