Difference between revisions of "CAMP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-L-KYNURENINE == * common-name: ** 3-hydroxy-l-kynurenine * molecular-weight: ** 224.216 * inchi-key: ** vckpuufaignjhc-lurjtmie...") |
(Created page with "Category:metabolite == Metabolite CAMP == * common-name: ** cyclic-amp * molecular-weight: ** 328.201 * inchi-key: ** ivomouwhdpkrll-kqynxxcusa-m * smiles: ** c3(op(=o)([o...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CAMP == |
* common-name: | * common-name: | ||
− | ** | + | ** cyclic-amp |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 328.201 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ivomouwhdpkrll-kqynxxcusa-m |
* smiles: | * smiles: | ||
− | ** | + | ** c3(op(=o)([o-])oc4(c(o)c(n2(c1(=c(c(=nc=n1)n)n=c2)))oc34)) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN0-5038]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=cyclic-amp}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=328.201}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ivomouwhdpkrll-kqynxxcusa-m}} |
Latest revision as of 19:32, 17 March 2021
Contents
Metabolite CAMP
- common-name:
- cyclic-amp
- molecular-weight:
- 328.201
- inchi-key:
- ivomouwhdpkrll-kqynxxcusa-m
- smiles:
- c3(op(=o)([o-])oc4(c(o)c(n2(c1(=c(c(=nc=n1)n)n=c2)))oc34))