Difference between revisions of "CPD-514"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GDP-TP == * common-name: ** pppgpp * molecular-weight: ** 677.095 * inchi-key: ** kcpmacxzaitqax-uuokfmhzsa-h * smiles: ** c(op([o-])(=o)...")
(Created page with "Category:metabolite == Metabolite CPD-514 == * common-name: ** 3-oxo-3-phenylpropanoyl-coa * molecular-weight: ** 909.648 * inchi-key: ** nhdpiyiccbknnj-fueukbnzsa-j * smi...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GDP-TP ==
+
== Metabolite CPD-514 ==
 
* common-name:
 
* common-name:
** pppgpp
+
** 3-oxo-3-phenylpropanoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 677.095
+
** 909.648
 
* inchi-key:
 
* inchi-key:
** kcpmacxzaitqax-uuokfmhzsa-h
+
** nhdpiyiccbknnj-fueukbnzsa-j
 
* smiles:
 
* smiles:
** c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-2006]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GTPPYPHOSKIN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pppgpp}}
+
{{#set: common-name=3-oxo-3-phenylpropanoyl-coa}}
{{#set: molecular-weight=677.095}}
+
{{#set: molecular-weight=909.648}}
{{#set: inchi-key=inchikey=kcpmacxzaitqax-uuokfmhzsa-h}}
+
{{#set: inchi-key=inchikey=nhdpiyiccbknnj-fueukbnzsa-j}}

Latest revision as of 19:33, 17 March 2021

Metabolite CPD-514

  • common-name:
    • 3-oxo-3-phenylpropanoyl-coa
  • molecular-weight:
    • 909.648
  • inchi-key:
    • nhdpiyiccbknnj-fueukbnzsa-j
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality