Difference between revisions of "CPD-514"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GDP-TP == * common-name: ** pppgpp * molecular-weight: ** 677.095 * inchi-key: ** kcpmacxzaitqax-uuokfmhzsa-h * smiles: ** c(op([o-])(=o)...") |
(Created page with "Category:metabolite == Metabolite CPD-514 == * common-name: ** 3-oxo-3-phenylpropanoyl-coa * molecular-weight: ** 909.648 * inchi-key: ** nhdpiyiccbknnj-fueukbnzsa-j * smi...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-514 == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-oxo-3-phenylpropanoyl-coa |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 909.648 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** nhdpiyiccbknnj-fueukbnzsa-j |
* smiles: | * smiles: | ||
− | ** c( | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-2006]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-oxo-3-phenylpropanoyl-coa}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=909.648}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nhdpiyiccbknnj-fueukbnzsa-j}} |
Latest revision as of 19:33, 17 March 2021
Contents
Metabolite CPD-514
- common-name:
- 3-oxo-3-phenylpropanoyl-coa
- molecular-weight:
- 909.648
- inchi-key:
- nhdpiyiccbknnj-fueukbnzsa-j
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]